C11H15N3O2S3 — CID 63659080
N-methyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 63659080) has the molecular formula C11H15N3O2S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is N-methyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63659080 |
| Molecular Formula | C11H15N3O2S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-methyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(CSCCS(C)(=O)=O)nc2sccc12 |
| InChI | InChI=1S/C11H15N3O2S3/c1-12-10-8-3-4-18-11(8)14-9(13-10)7-17-5-6-19(2,15)16/h3-4H,5-7H2,1-2H3,(H,12,13,14) |
| InChIKey | ADUBGUSKEZYZFW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|