C12H18N4O2S3 — CID 63659781
[5,6-dimethyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 63659781) has the molecular formula C12H18N4O2S3 and a molecular weight of 346.50 g/mol. Its IUPAC name is [5,6-dimethyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [5,6-dimethyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63659781 |
| Molecular Formula | C12H18N4O2S3 |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | [5,6-dimethyl-2-(2-methylsulfonylethylsulfanylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1sc2nc(CSCCS(C)(=O)=O)nc(NN)c2c1C |
| InChI | InChI=1S/C12H18N4O2S3/c1-7-8(2)20-12-10(7)11(16-13)14-9(15-12)6-19-4-5-21(3,17)18/h4-6,13H2,1-3H3,(H,14,15,16) |
| InChIKey | MLSPTPSELDHRFJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|