C11H15N3OS2 — CID 43502532
2-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]ethanol (PubChem CID 43502532) has the molecular formula C11H15N3OS2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]ethanol.
| Compound Name | 2-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 43502532 |
| Molecular Formula | C11H15N3OS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]ethanol |
| SMILES | Cc1sc2nc(CSCCO)nc(N)c2c1C |
| InChI | InChI=1S/C11H15N3OS2/c1-6-7(2)17-11-9(6)10(12)13-8(14-11)5-16-4-3-15/h15H,3-5H2,1-2H3,(H2,12,13,14) |
| InChIKey | LQVOKAACBLEHDY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|