C9H10ClN3S — CID 9115252
2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 9115252) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9115252 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(CCl)nc(N)c2c1C |
| InChI | InChI=1S/C9H10ClN3S/c1-4-5(2)14-9-7(4)8(11)12-6(3-10)13-9/h3H2,1-2H3,(H2,11,12,13) |
| InChIKey | JBYRXDIWCGCYCN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|