C13H19N3S2 — CID 60701127
2-(butylsulfanylmethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 60701127) has the molecular formula C13H19N3S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 2-(butylsulfanylmethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(butylsulfanylmethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60701127 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(butylsulfanylmethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCSCc1nc(N)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C13H19N3S2/c1-4-5-6-17-7-10-15-12(14)11-8(2)9(3)18-13(11)16-10/h4-7H2,1-3H3,(H2,14,15,16) |
| InChIKey | HCHSQDUDPJSVNN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|