About 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide
2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide (PubChem CID 114234605) has the molecular formula C12H17N5OS2
and a molecular weight of 311.44 g/mol. Its IUPAC name is 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide |
| PubChem CID | 114234605 |
| Molecular Formula | C12H17N5OS2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CSCc1nc(NN)c2ccsc2n1 |
| InChI | InChI=1S/C12H17N5OS2/c1-7(2)14-10(18)6-19-5-9-15-11(17-13)8-3-4-20-12(8)16-9/h3-4,7H,5-6,13H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | SIFRNHBBPLMCDR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide?
The IUPAC name of 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide (CID 114234605) is 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide is CC(C)NC(=O)CSCc1nc(NN)c2ccsc2n1.
What is the InChIKey of 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide?
The InChIKey is SIFRNHBBPLMCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5OS2/c1-7(2)14-10(18)6-19-5-9-15-11(17-13)8-3-4-20-12(8)16-9/h3-4,7H,5-6,13H2,1-2H3,(H,14,18)(H,15,16,17).
What are the key properties of 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide?
2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide has a molecular weight of 311.44 g/mol, XLogP of 1.73, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide is sourced from PubChem (CID 114234605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).