C12H17N5OS2 — CID 114234605
2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide (PubChem CID 114234605) has the molecular formula C12H17N5OS2 and a molecular weight of 311.44 g/mol. Its IUPAC name is 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide.
| Compound Name | 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 114234605 |
| Molecular Formula | C12H17N5OS2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CSCc1nc(NN)c2ccsc2n1 |
| InChI | InChI=1S/C12H17N5OS2/c1-7(2)14-10(18)6-19-5-9-15-11(17-13)8-3-4-20-12(8)16-9/h3-4,7H,5-6,13H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | SIFRNHBBPLMCDR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|