About 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol
3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol (PubChem CID 66103205) has the molecular formula C11H15N3OS2
and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol |
| PubChem CID | 66103205 |
| Molecular Formula | C11H15N3OS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol |
| SMILES | CC(CO)CSCc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C11H15N3OS2/c1-7(4-15)5-16-6-9-13-10(12)8-2-3-17-11(8)14-9/h2-3,7,15H,4-6H2,1H3,(H2,12,13,14) |
| InChIKey | RDDVUCNATNPFIG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol?
The IUPAC name of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol (CID 66103205) is 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol.
What is the SMILES notation for 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol?
The canonical SMILES for 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol is CC(CO)CSCc1nc(N)c2ccsc2n1.
What is the InChIKey of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol?
The InChIKey is RDDVUCNATNPFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS2/c1-7(4-15)5-16-6-9-13-10(12)8-2-3-17-11(8)14-9/h2-3,7,15H,4-6H2,1H3,(H2,12,13,14).
What are the key properties of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol?
3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol has a molecular weight of 269.39 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-2-methylpropan-1-ol is sourced from PubChem (CID 66103205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).