C10H15ClN2OS — CID 146085974
N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-chloroacetamide (PubChem CID 146085974) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-chloroacetamide.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 146085974 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-2-chloroacetamide |
| SMILES | CC(C)(C)c1nc(CNC(=O)CCl)cs1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-10(2,3)9-13-7(6-15-9)5-12-8(14)4-11/h6H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | WJVAYINOZRBPGH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|