C17H20N4O3S — CID 51197502
N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyrazine-2-carboxamide (PubChem CID 51197502) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyrazine-2-carboxamide.
| Compound Name | N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 51197502 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[(4-piperidin-1-ylsulfonylphenyl)methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1cnccn1 |
| InChI | InChI=1S/C17H20N4O3S/c22-17(16-13-18-8-9-19-16)20-12-14-4-6-15(7-5-14)25(23,24)21-10-2-1-3-11-21/h4-9,13H,1-3,10-12H2,(H,20,22) |
| InChIKey | KSIKUOHBXQCXLQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |