C18H20BrN3OS — CID 55745505
(E)-3-(5-bromothiophen-2-yl)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]prop-2-enamide (PubChem CID 55745505) has the molecular formula C18H20BrN3OS and a molecular weight of 406.35 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55745505 |
| Molecular Formula | C18H20BrN3OS |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)NCc1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C18H20BrN3OS/c19-16-7-5-15(24-16)6-9-18(23)21-13-14-4-8-17(20-12-14)22-10-2-1-3-11-22/h4-9,12H,1-3,10-11,13H2,(H,21,23)/b9-6+ |
| InChIKey | PGGIPXXTCVVADM-RMKNXTFCSA-N |
| XLogP | 4.23 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|