C26H28FN5O2S — CID 55972634
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]prop-2-enamide (PubChem CID 55972634) has the molecular formula C26H28FN5O2S and a molecular weight of 493.61 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55972634 |
| Molecular Formula | C26H28FN5O2S |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]prop-2-enamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)NCc2ccc(N3CCCCCC3)nc2)cs1)c1ccccc1F |
| InChI | InChI=1S/C26H28FN5O2S/c1-19(33)32(23-9-5-4-8-22(23)27)26-30-21(18-35-26)11-13-25(34)29-17-20-10-12-24(28-16-20)31-14-6-2-3-7-15-31/h4-5,8-13,16,18H,2-3,6-7,14-15,17H2,1H3,(H,29,34)/b13-11+ |
| InChIKey | VRKINRRQVIAUTJ-ACCUITESSA-N |
| XLogP | 5.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|