C25H31FN4O3S — CID 37259775
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide (PubChem CID 37259775) has the molecular formula C25H31FN4O3S and a molecular weight of 486.61 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 37259775 |
| Molecular Formula | C25H31FN4O3S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]prop-2-enamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)NCC2(N3CCOCC3)CCCCC2)cs1)c1ccccc1F |
| InChI | InChI=1S/C25H31FN4O3S/c1-19(31)30(22-8-4-3-7-21(22)26)24-28-20(17-34-24)9-10-23(32)27-18-25(11-5-2-6-12-25)29-13-15-33-16-14-29/h3-4,7-10,17H,2,5-6,11-16,18H2,1H3,(H,27,32)/b10-9+ |
| InChIKey | FGEDKRGXJZOMKM-MDZDMXLPSA-N |
| XLogP | 4.13 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|