C10H9Br2NOS — CID 47439352
(E)-N-(2-bromoprop-2-enyl)-3-(5-bromothiophen-2-yl)prop-2-enamide (PubChem CID 47439352) has the molecular formula C10H9Br2NOS and a molecular weight of 351.06 g/mol. Its IUPAC name is (E)-N-(2-bromoprop-2-enyl)-3-(5-bromothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromoprop-2-enyl)-3-(5-bromothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47439352 |
| Molecular Formula | C10H9Br2NOS |
| Molecular Weight | 351.06 g/mol |
| Exact Mass | 348.88 |
| IUPAC Name | (E)-N-(2-bromoprop-2-enyl)-3-(5-bromothiophen-2-yl)prop-2-enamide |
| SMILES | C=C(Br)CNC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C10H9Br2NOS/c1-7(11)6-13-10(14)5-3-8-2-4-9(12)15-8/h2-5H,1,6H2,(H,13,14)/b5-3+ |
| InChIKey | BVPQEUYHMBKPKO-HWKANZROSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.06 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|