C10H9BrClNOS — CID 115594447
(E)-N-(2-bromoprop-2-enyl)-3-(5-chlorothiophen-2-yl)prop-2-enamide (PubChem CID 115594447) has the molecular formula C10H9BrClNOS and a molecular weight of 306.61 g/mol. Its IUPAC name is (E)-N-(2-bromoprop-2-enyl)-3-(5-chlorothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromoprop-2-enyl)-3-(5-chlorothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 115594447 |
| Molecular Formula | C10H9BrClNOS |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 304.93 |
| IUPAC Name | (E)-N-(2-bromoprop-2-enyl)-3-(5-chlorothiophen-2-yl)prop-2-enamide |
| SMILES | C=C(Br)CNC(=O)/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H9BrClNOS/c1-7(11)6-13-10(14)5-3-8-2-4-9(12)15-8/h2-5H,1,6H2,(H,13,14)/b5-3+ |
| InChIKey | DGPANNMNBQZMPN-HWKANZROSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|