C9H10ClNO2S — CID 43394522
(E)-3-(5-chlorothiophen-2-yl)-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 43394522) has the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43394522 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)s1)NCCO |
| InChI | InChI=1S/C9H10ClNO2S/c10-8-3-1-7(14-8)2-4-9(13)11-5-6-12/h1-4,12H,5-6H2,(H,11,13)/b4-2+ |
| InChIKey | YOEZESHBVPNMSI-DUXPYHPUSA-N |
| XLogP | 1.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|