C15H14ClNO2S — CID 78847155
(E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 78847155) has the molecular formula C15H14ClNO2S and a molecular weight of 307.80 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78847155 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2)s1)NCCO |
| InChI | InChI=1S/C15H14ClNO2S/c16-12-3-1-11(2-4-12)14-7-5-13(20-14)6-8-15(19)17-9-10-18/h1-8,18H,9-10H2,(H,17,19)/b8-6+ |
| InChIKey | HPOVPTVTHDMGEC-SOFGYWHQSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|