C18H15BrN2OS2 — CID 99804528
(E)-3-[5-(4-bromophenyl)thiophen-2-yl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide (PubChem CID 99804528) has the molecular formula C18H15BrN2OS2 and a molecular weight of 419.37 g/mol. Its IUPAC name is (E)-3-[5-(4-bromophenyl)thiophen-2-yl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-bromophenyl)thiophen-2-yl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 99804528 |
| Molecular Formula | C18H15BrN2OS2 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | (E)-3-[5-(4-bromophenyl)thiophen-2-yl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide |
| SMILES | Cc1ncsc1CNC(=O)/C=C/c1ccc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C18H15BrN2OS2/c1-12-17(23-11-21-12)10-20-18(22)9-7-15-6-8-16(24-15)13-2-4-14(19)5-3-13/h2-9,11H,10H2,1H3,(H,20,22)/b9-7+ |
| InChIKey | AXZGNPKRUYWGCO-VQHVLOKHSA-N |
| XLogP | 5.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|