C17H14BrFN4OS — CID 86954194
(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide (PubChem CID 86954194) has the molecular formula C17H14BrFN4OS and a molecular weight of 421.30 g/mol. Its IUPAC name is (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 86954194 |
| Molecular Formula | C17H14BrFN4OS |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[(4-methyl-1,3-thiazol-5-yl)methyl]prop-2-enamide |
| SMILES | Cc1ncsc1CNC(=O)/C=C/c1ccc(-n2cc(Br)cn2)c(F)c1 |
| InChI | InChI=1S/C17H14BrFN4OS/c1-11-16(25-10-21-11)8-20-17(24)5-3-12-2-4-15(14(19)6-12)23-9-13(18)7-22-23/h2-7,9-10H,8H2,1H3,(H,20,24)/b5-3+ |
| InChIKey | OWDGSUUCIZJKBC-HWKANZROSA-N |
| XLogP | 3.87 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|