C17H17BrFN3O3S — CID 86953976
(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 86953976) has the molecular formula C17H17BrFN3O3S and a molecular weight of 442.31 g/mol. Its IUPAC name is (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 86953976 |
| Molecular Formula | C17H17BrFN3O3S |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CC1(NC(=O)/C=C/c2ccc(-n3cc(Br)cn3)c(F)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H17BrFN3O3S/c1-17(6-7-26(24,25)11-17)21-16(23)5-3-12-2-4-15(14(19)8-12)22-10-13(18)9-20-22/h2-5,8-10H,6-7,11H2,1H3,(H,21,23)/b5-3+ |
| InChIKey | IATPSIJHGRRLLT-HWKANZROSA-N |
| XLogP | 2.48 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|