C17H17BrFN3O3 — CID 86954051
methyl 2-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]amino]-2-methylpropanoate (PubChem CID 86954051) has the molecular formula C17H17BrFN3O3 and a molecular weight of 410.24 g/mol. Its IUPAC name is methyl 2-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 86954051 |
| Molecular Formula | C17H17BrFN3O3 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | methyl 2-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)/C=C/c1ccc(-n2cc(Br)cn2)c(F)c1 |
| InChI | InChI=1S/C17H17BrFN3O3/c1-17(2,16(24)25-3)21-15(23)7-5-11-4-6-14(13(19)8-11)22-10-12(18)9-20-22/h4-10H,1-3H3,(H,21,23)/b7-5+ |
| InChIKey | XAEGVDBVRSLKLD-FNORWQNLSA-N |
| XLogP | 2.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|