C19H19BrFN3O3 — CID 86957229
(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)prop-2-en-1-one (PubChem CID 86957229) has the molecular formula C19H19BrFN3O3 and a molecular weight of 436.28 g/mol. Its IUPAC name is (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86957229 |
| Molecular Formula | C19H19BrFN3O3 |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-n2cc(Br)cn2)c(F)c1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C19H19BrFN3O3/c20-15-12-22-24(13-15)17-3-1-14(11-16(17)21)2-4-18(25)23-7-5-19(6-8-23)26-9-10-27-19/h1-4,11-13H,5-10H2/b4-2+ |
| InChIKey | PMYNOLJBSDXOBR-DUXPYHPUSA-N |
| XLogP | 3.15 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|