C20H17BrFN3O2 — CID 86954073
(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[2-(methoxymethyl)phenyl]prop-2-enamide (PubChem CID 86954073) has the molecular formula C20H17BrFN3O2 and a molecular weight of 430.28 g/mol. Its IUPAC name is (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[2-(methoxymethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[2-(methoxymethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86954073 |
| Molecular Formula | C20H17BrFN3O2 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | (E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]-N-[2-(methoxymethyl)phenyl]prop-2-enamide |
| SMILES | COCc1ccccc1NC(=O)/C=C/c1ccc(-n2cc(Br)cn2)c(F)c1 |
| InChI | InChI=1S/C20H17BrFN3O2/c1-27-13-15-4-2-3-5-18(15)24-20(26)9-7-14-6-8-19(17(22)10-14)25-12-16(21)11-23-25/h2-12H,13H2,1H3,(H,24,26)/b9-7+ |
| InChIKey | OLBGGCXTFWYBIH-VQHVLOKHSA-N |
| XLogP | 4.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|