C19H21BrFN3O3 — CID 86954174
methyl 3-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]-ethylamino]-2-methylpropanoate (PubChem CID 86954174) has the molecular formula C19H21BrFN3O3 and a molecular weight of 438.30 g/mol. Its IUPAC name is methyl 3-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]-ethylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]-ethylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 86954174 |
| Molecular Formula | C19H21BrFN3O3 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | methyl 3-[[(E)-3-[4-(4-bromopyrazol-1-yl)-3-fluorophenyl]prop-2-enoyl]-ethylamino]-2-methylpropanoate |
| SMILES | CCN(CC(C)C(=O)OC)C(=O)/C=C/c1ccc(-n2cc(Br)cn2)c(F)c1 |
| InChI | InChI=1S/C19H21BrFN3O3/c1-4-23(11-13(2)19(26)27-3)18(25)8-6-14-5-7-17(16(21)9-14)24-12-15(20)10-22-24/h5-10,12-13H,4,11H2,1-3H3/b8-6+ |
| InChIKey | USABEKASLKZCBD-SOFGYWHQSA-N |
| XLogP | 3.44 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|