C12H15NO4S — CID 18155683
(E)-3-(furan-2-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 18155683) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18155683 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(3-methyl-1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CC1(NC(=O)/C=C/c2ccco2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO4S/c1-12(6-8-18(15,16)9-12)13-11(14)5-4-10-3-2-7-17-10/h2-5,7H,6,8-9H2,1H3,(H,13,14)/b5-4+ |
| InChIKey | GSVRVUVMMIUVTP-SNAWJCMRSA-N |
| XLogP | 0.99 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|