C16H22N2O4 — CID 143504725
1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-(2-hydroxyethyl)cyclohexane-1-carboxamide (PubChem CID 143504725) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-(2-hydroxyethyl)cyclohexane-1-carboxamide.
| Compound Name | 1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-(2-hydroxyethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143504725 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-(2-hydroxyethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(/C=C/c1ccco1)NC1(C(=O)NCCO)CCCCC1 |
| InChI | InChI=1S/C16H22N2O4/c19-11-10-17-15(21)16(8-2-1-3-9-16)18-14(20)7-6-13-5-4-12-22-13/h4-7,12,19H,1-3,8-11H2,(H,17,21)(H,18,20)/b7-6+ |
| InChIKey | DSVBNXNYZIEQRL-VOTSOKGWSA-N |
| XLogP | 1.22 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|