C19H26N2O5S — CID 24737876
(2S)-2-[[1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]cyclohexanecarbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 24737876) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is (2S)-2-[[1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]cyclohexanecarbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]cyclohexanecarbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 24737876 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2S)-2-[[1-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]cyclohexanecarbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)C1(NC(=O)/C=C/c2ccco2)CCCCC1)C(=O)O |
| InChI | InChI=1S/C19H26N2O5S/c1-27-13-9-15(17(23)24)20-18(25)19(10-3-2-4-11-19)21-16(22)8-7-14-6-5-12-26-14/h5-8,12,15H,2-4,9-11,13H2,1H3,(H,20,25)(H,21,22)(H,23,24)/b8-7+/t15-/m0/s1 |
| InChIKey | KENIAKFFZLKQKW-KIUWMYQTSA-N |
| XLogP | 2.43 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|