C14H16BrN3OS — CID 76931706
3-(5-bromothiophen-2-yl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]prop-2-enamide (PubChem CID 76931706) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]prop-2-enamide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 76931706 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]prop-2-enamide |
| SMILES | Cc1[nH]ncc1CCCNC(=O)C=Cc1ccc(Br)s1 |
| InChI | InChI=1S/C14H16BrN3OS/c1-10-11(9-17-18-10)3-2-8-16-14(19)7-5-12-4-6-13(15)20-12/h4-7,9H,2-3,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | XSPQLXGNPUGULJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|