C11H11BrN4OS — CID 103716625
(E)-3-(5-bromothiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide (PubChem CID 103716625) has the molecular formula C11H11BrN4OS and a molecular weight of 327.21 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 103716625 |
| Molecular Formula | C11H11BrN4OS |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(Br)s1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H11BrN4OS/c1-7(11-13-6-14-16-11)15-10(17)5-3-8-2-4-9(12)18-8/h2-7H,1H3,(H,15,17)(H,13,14,16)/b5-3+ |
| InChIKey | JZGWJEVZZHMQPL-HWKANZROSA-N |
| XLogP | 2.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|