C13H12Cl2N4O — CID 103741486
(E)-3-(3,5-dichlorophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide (PubChem CID 103741486) has the molecular formula C13H12Cl2N4O and a molecular weight of 311.17 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 103741486 |
| Molecular Formula | C13H12Cl2N4O |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1cc(Cl)cc(Cl)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H12Cl2N4O/c1-8(13-16-7-17-19-13)18-12(20)3-2-9-4-10(14)6-11(15)5-9/h2-8H,1H3,(H,18,20)(H,16,17,19)/b3-2+ |
| InChIKey | BJCHFHIXSDASIB-NSCUHMNNSA-N |
| XLogP | 3.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|