C16H21Cl2NO2 — CID 106352966
(E)-3-(3,5-dichlorophenyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)prop-2-enamide (PubChem CID 106352966) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.26 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 106352966 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)prop-2-enamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO2/c1-16(2,3)14(6-7-20)19-15(21)5-4-11-8-12(17)10-13(18)9-11/h4-5,8-10,14,20H,6-7H2,1-3H3,(H,19,21)/b5-4+ |
| InChIKey | CCJJTEKEBSHJGE-SNAWJCMRSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|