C20H17ClFN3O4 — CID 42409075
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 42409075) has the molecular formula C20H17ClFN3O4 and a molecular weight of 417.82 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 42409075 |
| Molecular Formula | C20H17ClFN3O4 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-[5-(2-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | C[C@@H](OC(=O)CCc1ncc(-c2ccccc2F)o1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C20H17ClFN3O4/c1-12(20(27)25-15-7-4-10-23-19(15)21)28-18(26)9-8-17-24-11-16(29-17)13-5-2-3-6-14(13)22/h2-7,10-12H,8-9H2,1H3,(H,25,27)/t12-/m1/s1 |
| InChIKey | PJHWDVVQOYSIJM-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|