C17H16ClFN2O3 — CID 55893583
2-chloro-N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-6-fluorobenzamide (PubChem CID 55893583) has the molecular formula C17H16ClFN2O3 and a molecular weight of 350.78 g/mol. Its IUPAC name is 2-chloro-N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 55893583 |
| Molecular Formula | C17H16ClFN2O3 |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-chloro-N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-6-fluorobenzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H16ClFN2O3/c1-21(2)17(23)10-7-8-14(24-3)13(9-10)20-16(22)15-11(18)5-4-6-12(15)19/h4-9H,1-3H3,(H,20,22) |
| InChIKey | RMPYIJMQRRCLMJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |