C19H16ClFN4O2 — CID 113048572
2-chloro-6-fluoro-N-[6-(2-methoxy-5-methylanilino)pyridazin-3-yl]benzamide (PubChem CID 113048572) has the molecular formula C19H16ClFN4O2 and a molecular weight of 386.81 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[6-(2-methoxy-5-methylanilino)pyridazin-3-yl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[6-(2-methoxy-5-methylanilino)pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113048572 |
| Molecular Formula | C19H16ClFN4O2 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-chloro-6-fluoro-N-[6-(2-methoxy-5-methylanilino)pyridazin-3-yl]benzamide |
| SMILES | COc1ccc(C)cc1Nc1ccc(NC(=O)c2c(F)cccc2Cl)nn1 |
| InChI | InChI=1S/C19H16ClFN4O2/c1-11-6-7-15(27-2)14(10-11)22-16-8-9-17(25-24-16)23-19(26)18-12(20)4-3-5-13(18)21/h3-10H,1-2H3,(H,22,24)(H,23,25,26) |
| InChIKey | PYIXOEPSFSFCLK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |