C23H17N3O4 — CID 50764346
N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzamide (PubChem CID 50764346) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 50764346 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccccc1-c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C23H17N3O4/c27-22(24-13-15-10-11-19-20(12-15)29-14-28-19)17-8-4-5-9-18(17)23-25-21(26-30-23)16-6-2-1-3-7-16/h1-12H,13-14H2,(H,24,27) |
| InChIKey | YNKXCUQZKYVHEX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |