C19H15ClN4O3 — CID 109282628
N-(1,3-benzodioxol-5-ylmethyl)-5-(3-chloroanilino)pyrazine-2-carboxamide (PubChem CID 109282628) has the molecular formula C19H15ClN4O3 and a molecular weight of 382.81 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(3-chloroanilino)pyrazine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(3-chloroanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109282628 |
| Molecular Formula | C19H15ClN4O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(3-chloroanilino)pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cnc(Nc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C19H15ClN4O3/c20-13-2-1-3-14(7-13)24-18-10-21-15(9-22-18)19(25)23-8-12-4-5-16-17(6-12)27-11-26-16/h1-7,9-10H,8,11H2,(H,22,24)(H,23,25) |
| InChIKey | AKVVTXDOHPAHRR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |