C22H30N4 — CID 112869350
4-N-benzyl-6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-ethyl-2-methylpyrimidine-4,6-diamine (PubChem CID 112869350) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-N-benzyl-6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-ethyl-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-benzyl-6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-ethyl-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112869350 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 4-N-benzyl-6-N-[2-(cyclohexen-1-yl)ethyl]-4-N-ethyl-2-methylpyrimidine-4,6-diamine |
| SMILES | CCN(Cc1ccccc1)c1cc(NCCC2=CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C22H30N4/c1-3-26(17-20-12-8-5-9-13-20)22-16-21(24-18(2)25-22)23-15-14-19-10-6-4-7-11-19/h5,8-10,12-13,16H,3-4,6-7,11,14-15,17H2,1-2H3,(H,23,24,25) |
| InChIKey | SBLNWODDLWJWID-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|