C18H16F3N5 — CID 112861914
4-N-methyl-4-N-(2-pyridin-4-ylethyl)-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112861914) has the molecular formula C18H16F3N5 and a molecular weight of 359.36 g/mol. Its IUPAC name is 4-N-methyl-4-N-(2-pyridin-4-ylethyl)-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-methyl-4-N-(2-pyridin-4-ylethyl)-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112861914 |
| Molecular Formula | C18H16F3N5 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-N-methyl-4-N-(2-pyridin-4-ylethyl)-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CN(CCc1ccncc1)c1cc(Nc2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C18H16F3N5/c1-26(9-6-12-4-7-22-8-5-12)16-10-15(23-11-24-16)25-14-3-2-13(19)17(20)18(14)21/h2-5,7-8,10-11H,6,9H2,1H3,(H,23,24,25) |
| InChIKey | JLCXRRKLMFKFNA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|