C16H23N5 — CID 112860603
4-N,4-N-dipropyl-6-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112860603) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-N,4-N-dipropyl-6-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dipropyl-6-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112860603 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-N,4-N-dipropyl-6-N-(pyridin-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CCCN(CCC)c1cc(NCc2ccccn2)ncn1 |
| InChI | InChI=1S/C16H23N5/c1-3-9-21(10-4-2)16-11-15(19-13-20-16)18-12-14-7-5-6-8-17-14/h5-8,11,13H,3-4,9-10,12H2,1-2H3,(H,18,19,20) |
| InChIKey | NSFYCEYYFKHMDA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |