C12H24N6 — CID 80895944
4-N-ethyl-4-N-(2-ethylbutyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80895944) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is 4-N-ethyl-4-N-(2-ethylbutyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-4-N-(2-ethylbutyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80895944 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 4-N-ethyl-4-N-(2-ethylbutyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CCC(CC)CN(CC)c1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C12H24N6/c1-4-9(5-2)8-18(6-3)11-7-10(17-14)15-12(13)16-11/h7,9H,4-6,8,14H2,1-3H3,(H3,13,15,16,17) |
| InChIKey | QIWYCMQGSKSWGW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|