C13H15BrN4S — CID 80947692
[6-(3-bromophenyl)sulfanyl-2-propylpyrimidin-4-yl]hydrazine (PubChem CID 80947692) has the molecular formula C13H15BrN4S and a molecular weight of 339.26 g/mol. Its IUPAC name is [6-(3-bromophenyl)sulfanyl-2-propylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3-bromophenyl)sulfanyl-2-propylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80947692 |
| Molecular Formula | C13H15BrN4S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [6-(3-bromophenyl)sulfanyl-2-propylpyrimidin-4-yl]hydrazine |
| SMILES | CCCc1nc(NN)cc(Sc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C13H15BrN4S/c1-2-4-11-16-12(18-15)8-13(17-11)19-10-6-3-5-9(14)7-10/h3,5-8H,2,4,15H2,1H3,(H,16,17,18) |
| InChIKey | SRIICLIGWKMXRO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|