C15H16BrN3S — CID 80963648
6-(3-bromophenyl)sulfanyl-2-cyclopropyl-N-ethylpyrimidin-4-amine (PubChem CID 80963648) has the molecular formula C15H16BrN3S and a molecular weight of 350.29 g/mol. Its IUPAC name is 6-(3-bromophenyl)sulfanyl-2-cyclopropyl-N-ethylpyrimidin-4-amine.
| Compound Name | 6-(3-bromophenyl)sulfanyl-2-cyclopropyl-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80963648 |
| Molecular Formula | C15H16BrN3S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 6-(3-bromophenyl)sulfanyl-2-cyclopropyl-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(Sc2cccc(Br)c2)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H16BrN3S/c1-2-17-13-9-14(19-15(18-13)10-6-7-10)20-12-5-3-4-11(16)8-12/h3-5,8-10H,2,6-7H2,1H3,(H,17,18,19) |
| InChIKey | OXALZKKCSBFTTC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |