C14H15ClN4S — CID 80964386
6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethylpyrimidin-4-amine (PubChem CID 80964386) has the molecular formula C14H15ClN4S and a molecular weight of 306.82 g/mol. Its IUPAC name is 6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethylpyrimidin-4-amine.
| Compound Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80964386 |
| Molecular Formula | C14H15ClN4S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(Sc2ncccc2Cl)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H15ClN4S/c1-2-16-11-8-12(19-13(18-11)9-5-6-9)20-14-10(15)4-3-7-17-14/h3-4,7-9H,2,5-6H2,1H3,(H,16,18,19) |
| InChIKey | YROKKQUEXAXGFH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |