C15H17ClN4S — CID 80962862
6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-propylpyrimidin-4-amine (PubChem CID 80962862) has the molecular formula C15H17ClN4S and a molecular weight of 320.85 g/mol. Its IUPAC name is 6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-propylpyrimidin-4-amine.
| Compound Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80962862 |
| Molecular Formula | C15H17ClN4S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-2-cyclopropyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(Sc2ncccc2Cl)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H17ClN4S/c1-2-7-17-12-9-13(20-14(19-12)10-5-6-10)21-15-11(16)4-3-8-18-15/h3-4,8-10H,2,5-7H2,1H3,(H,17,19,20) |
| InChIKey | JHYRPPKLGCMBJT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |