C13H15ClN4S — CID 80946945
6-[(3-chloro-2-pyridinyl)sulfanyl]-N-methyl-2-propylpyrimidin-4-amine (PubChem CID 80946945) has the molecular formula C13H15ClN4S and a molecular weight of 294.81 g/mol. Its IUPAC name is 6-[(3-chloro-2-pyridinyl)sulfanyl]-N-methyl-2-propylpyrimidin-4-amine.
| Compound Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-N-methyl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80946945 |
| Molecular Formula | C13H15ClN4S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-N-methyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NC)cc(Sc2ncccc2Cl)n1 |
| InChI | InChI=1S/C13H15ClN4S/c1-3-5-10-17-11(15-2)8-12(18-10)19-13-9(14)6-4-7-16-13/h4,6-8H,3,5H2,1-2H3,(H,15,17,18) |
| InChIKey | SXDYJUGOVFWBRL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |