C19H20ClN5 — CID 112877996
4-N-(3-chlorophenyl)-6-N-[4-(dimethylamino)phenyl]-2-methylpyrimidine-4,6-diamine (PubChem CID 112877996) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-6-N-[4-(dimethylamino)phenyl]-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-6-N-[4-(dimethylamino)phenyl]-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112877996 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-N-(3-chlorophenyl)-6-N-[4-(dimethylamino)phenyl]-2-methylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2ccc(N(C)C)cc2)cc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H20ClN5/c1-13-21-18(23-15-7-9-17(10-8-15)25(2)3)12-19(22-13)24-16-6-4-5-14(20)11-16/h4-12H,1-3H3,(H2,21,22,23,24) |
| InChIKey | TUBVAKOXTVKZIR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|