C20H19N5 — CID 112877571
4-[[6-(2-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112877571) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 4-[[6-(2-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[6-(2-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112877571 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-[[6-(2-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCc1ccccc1Nc1cc(Nc2ccc(C#N)cc2)nc(C)n1 |
| InChI | InChI=1S/C20H19N5/c1-3-16-6-4-5-7-18(16)25-20-12-19(22-14(2)23-20)24-17-10-8-15(13-21)9-11-17/h4-12H,3H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | LZZFTGDSXHGFLF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |