C18H24N4 — CID 112868692
4-N-cyclopentyl-6-N-(2-ethylphenyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112868692) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-(2-ethylphenyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-6-N-(2-ethylphenyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112868692 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-N-cyclopentyl-6-N-(2-ethylphenyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | CCc1ccccc1Nc1cc(NC2CCCC2)nc(C)n1 |
| InChI | InChI=1S/C18H24N4/c1-3-14-8-4-7-11-16(14)22-18-12-17(19-13(2)20-18)21-15-9-5-6-10-15/h4,7-8,11-12,15H,3,5-6,9-10H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | MZXNBSQSOGUFQE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |