About 4-phenyl-2,6-di(pyrazol-1-yl)pyridine
4-phenyl-2,6-di(pyrazol-1-yl)pyridine (PubChem CID 123601747) has the molecular formula C17H13N5
and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-phenyl-2,6-di(pyrazol-1-yl)pyridine.
Molecular Properties
| Compound Name | 4-phenyl-2,6-di(pyrazol-1-yl)pyridine |
| PubChem CID | 123601747 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-phenyl-2,6-di(pyrazol-1-yl)pyridine |
| SMILES | c1ccc(-c2cc(-n3cccn3)nc(-n3cccn3)c2)cc1 |
| InChI | InChI=1S/C17H13N5/c1-2-6-14(7-3-1)15-12-16(21-10-4-8-18-21)20-17(13-15)22-11-5-9-19-22/h1-13H |
| InChIKey | IWOCTKXXXPBLAP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-phenyl-2,6-di(pyrazol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2,6-di(pyrazol-1-yl)pyridine?
The IUPAC name of 4-phenyl-2,6-di(pyrazol-1-yl)pyridine (CID 123601747) is 4-phenyl-2,6-di(pyrazol-1-yl)pyridine.
What is the SMILES notation for 4-phenyl-2,6-di(pyrazol-1-yl)pyridine?
The canonical SMILES for 4-phenyl-2,6-di(pyrazol-1-yl)pyridine is c1ccc(-c2cc(-n3cccn3)nc(-n3cccn3)c2)cc1.
What is the InChIKey of 4-phenyl-2,6-di(pyrazol-1-yl)pyridine?
The InChIKey is IWOCTKXXXPBLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5/c1-2-6-14(7-3-1)15-12-16(21-10-4-8-18-21)20-17(13-15)22-11-5-9-19-22/h1-13H.
What are the key properties of 4-phenyl-2,6-di(pyrazol-1-yl)pyridine?
4-phenyl-2,6-di(pyrazol-1-yl)pyridine has a molecular weight of 287.33 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2,6-di(pyrazol-1-yl)pyridine is sourced from PubChem (CID 123601747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).