C48H33N9 — CID 174727426
2,4,6-tris(5-phenyl-2-pyrazol-1-ylphenyl)-1,3,5-triazine (PubChem CID 174727426) has the molecular formula C48H33N9 and a molecular weight of 735.86 g/mol. Its IUPAC name is 2,4,6-tris(5-phenyl-2-pyrazol-1-ylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(5-phenyl-2-pyrazol-1-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 174727426 |
| Molecular Formula | C48H33N9 |
| Molecular Weight | 735.86 g/mol |
| Exact Mass | 735.29 |
| IUPAC Name | 2,4,6-tris(5-phenyl-2-pyrazol-1-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-n3cccn3)c(-c3nc(-c4cc(-c5ccccc5)ccc4-n4cccn4)nc(-c4cc(-c5ccccc5)ccc4-n4cccn4)n3)c2)cc1 |
| InChI | InChI=1S/C48H33N9/c1-4-13-34(14-5-1)37-19-22-43(55-28-10-25-49-55)40(31-37)46-52-47(41-32-38(35-15-6-2-7-16-35)20-23-44(41)56-29-11-26-50-56)54-48(53-46)42-33-39(36-17-8-3-9-18-36)21-24-45(42)57-30-12-27-51-57/h1-33H |
| InChIKey | JCEIBKYVCGWOCX-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.86 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |