C19H15N5 — CID 123864479
4-(2-phenylethenyl)-2,6-di(pyrazol-1-yl)pyridine (PubChem CID 123864479) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-(2-phenylethenyl)-2,6-di(pyrazol-1-yl)pyridine.
| Compound Name | 4-(2-phenylethenyl)-2,6-di(pyrazol-1-yl)pyridine |
|---|---|
| PubChem CID | 123864479 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(2-phenylethenyl)-2,6-di(pyrazol-1-yl)pyridine |
| SMILES | C(=Cc1cc(-n2cccn2)nc(-n2cccn2)c1)c1ccccc1 |
| InChI | InChI=1S/C19H15N5/c1-2-6-16(7-3-1)8-9-17-14-18(23-12-4-10-20-23)22-19(15-17)24-13-5-11-21-24/h1-15H |
| InChIKey | QXGSXAGWZPJWOE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |